1.0 2016-09-30 22:52:48 UTC 2020-05-21 16:28:46 UTC BMDB0002217 BMDB02217 (S)-Methylmalonic acid semialdehyde (S)-Methylmalonic acid semialdehyde, also known as (s)-methylmalonic acid semialdehyde, belongs to the class of organic compounds known as 1,3-dicarbonyl compounds. These are carbonyl compounds with the generic formula O=C(R)C(H)C(R')=O, where R and R' can be any group (S)-Methylmalonic acid semialdehyde is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral (S)-Methylmalonic acid semialdehyde exists in all living organisms, ranging from bacteria to humans (S)-Methylmalonic acid semialdehyde participates in a number of enzymatic reactions, within cattle. In particular, (S)-Methylmalonic acid semialdehyde can be biosynthesized from (S)-3-hydroxyisobutyric acid through the action of the enzymes 3-hydroxyisobutyrate dehydrogenase, mitochondrial and enoyl-CoA hydratase, mitochondrial. In addition, (S)-Methylmalonic acid semialdehyde and L-glutamic acid can be biosynthesized from (S)-b-aminoisobutyric acid and oxoglutaric acid through the action of the enzyme 4-aminobutyrate aminotransferase, mitochondrial. In cattle, (S)-methylmalonic acid semialdehyde is involved in the metabolic pathway called the valine, leucine, and isoleucine degradation pathway. (S)-Methylmalonate semialdehyde (2S)-2-Methyl-3-oxopropanoate (2S)-2-Methyl-3-oxopropanoic acid C4H6O3 102.0886 102.031694058 (2S)-2-methyl-3-oxopropanoic acid (S)-methylmalonaldehydic acid 99043-16-0 C[C@@H](C=O)C(O)=O InChI=1S/C4H6O3/c1-3(2-5)4(6)7/h2-3H,1H3,(H,6,7)/t3-/m0/s1 VOKUMXABRRXHAR-VKHMYHEASA-N belongs to the class of organic compounds known as 1,3-dicarbonyl compounds. These are carbonyl compounds with the generic formula O=C(R)C(H)C(R')=O, where R and R' can be any group. Organic compounds Organic oxygen compounds Organooxygen compounds Carbonyl compounds 1,3-dicarbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Short-chain aldehydes 1,3-dicarbonyl compound Aldehyde Aliphatic acyclic compound Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Short-chain aldehyde Aliphatic acyclic compounds 2-methyl-3-oxopropanoic acid Oxo fatty acids aldehydic acid Solid logp -0.00 ALOGPS logs 0.42 ALOGPS logp 0.053 ChemAxon pka_strongest_acidic 3.98 ChemAxon pka_strongest_basic -7.2 ChemAxon iupac (2S)-2-methyl-3-oxopropanoic acid ChemAxon average_mass 102.0886 ChemAxon mono_mass 102.031694058 ChemAxon smiles C[C@@H](C=O)C(O)=O ChemAxon formula C4H6O3 ChemAxon inchi InChI=1S/C4H6O3/c1-3(2-5)4(6)7/h2-3H,1H3,(H,6,7)/t3-/m0/s1 ChemAxon inchikey VOKUMXABRRXHAR-VKHMYHEASA-N ChemAxon polar_surface_area 54.37 ChemAxon refractivity 22.64 ChemAxon polarizability 9.16 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon number_of_rings 0 ChemAxon bioavailability 1 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon Propanoate Metabolism SMP0087248 Valine, Leucine, and Isoleucine Degradation SMP0087234 Specdb::MsMs 28961 Specdb::MsMs 28962 Specdb::MsMs 28963 Specdb::MsMs 35519 Specdb::MsMs 35520 Specdb::MsMs 35521 Specdb::MsMs 2455066 Specdb::MsMs 2455067 Specdb::MsMs 2455068 Specdb::MsMs 2479726 Specdb::MsMs 2479727 Specdb::MsMs 2479728 Specdb::CMs 18408 Specdb::CMs 38322 Specdb::CMs 173491 Specdb::NmrOneD 332718 Specdb::NmrOneD 332719 Specdb::NmrOneD 332720 Specdb::NmrOneD 332721 Specdb::NmrOneD 332722 Specdb::NmrOneD 332723 Specdb::NmrOneD 332724 Specdb::NmrOneD 332725 Specdb::NmrOneD 332726 Specdb::NmrOneD 332727 Specdb::NmrOneD 332728 Specdb::NmrOneD 332729 Specdb::NmrOneD 332730 Specdb::NmrOneD 332731 Specdb::NmrOneD 332732 Specdb::NmrOneD 332733 Specdb::NmrOneD 332734 Specdb::NmrOneD 332735 Specdb::NmrOneD 332736 Specdb::NmrOneD 332737 FDB022912 4575365 5462303 27821 C06002 34698 6553 CH3-MALONATE-S-ALD BMDBP00260 Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial Q07536 ALDH6A1 Enzyme BMDBP00596 4-aminobutyrate aminotransferase, mitochondrial Q9BGI0 ABAT Enzyme BMDBP00677 Aldehyde oxidase 1 P48034 AOX1 Enzyme BMDBP00990 Aldehyde dehydrogenase, mitochondrial P20000 ALDH2 Enzyme