1.0 2016-09-30 23:00:40 UTC 2020-04-22 15:11:06 UTC BMDB0002511 BMDB02511 3,4,5-Trimethoxycinnamic acid 3,4,5-Trimethoxycinnamic acid, also known as 3,4,5-trimethoxyphenylacrylate or O-methylsinapate, belongs to the class of organic compounds known as coumaric acids and derivatives. These are aromatic compounds containing Aromatic compounds containing a cinnamic acid moiety (or a derivative thereof) hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. 3,4,5-Trimethoxycinnamic acid exists as a solid, possibly soluble (in water), and an extremely weak basic (essentially neutral) compound (based on its pKa) molecule. 3,4,5-Trimethoxycinnamate 3-(3,4,5-Trimethoxyphenyl)-2-propenoic acid 3,4,5-Trimethoxy cinnamate 3,4,5-Trimethoxy cinnamic acid 3,4,5-Trimethoxyphenylacrylate 3,4,5-Trimethoxyphenylacrylic acid O-Methylsinapate O-Methylsinapic acid (2E)-3-(3,4,5-Trimethoxyphenyl)prop-2-enoate 3,4,5-Trimethoxycinnamic acid C12H14O5 238.2366 238.084123558 (2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid 3,4,5-trimethoxycinnamic acid 90-50-6 COC1=CC(\C=C\C(O)=O)=CC(OC)=C1OC InChI=1S/C12H14O5/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h4-7H,1-3H3,(H,13,14)/b5-4+ YTFVRYKNXDADBI-SNAWJCMRSA-N belongs to the class of organic compounds known as coumaric acids and derivatives. These are aromatic compounds containing Aromatic compounds containing a cinnamic acid moiety (or a derivative thereof) hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Coumaric acids and derivatives Alkyl aryl ethers Anisoles Carbonyl compounds Carboxylic acids Cinnamic acids Hydrocarbon derivatives Methoxybenzenes Monocarboxylic acids and derivatives Organic oxides Phenoxy compounds Styrenes Alkyl aryl ether Anisole Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Coumaric acid or derivatives Ether Hydrocarbon derivative Methoxybenzene Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol ether Phenoxy compound Styrene Aromatic homomonocyclic compounds Solid melting_point 126 - 128 °C logp 2.24 ALOGPS logs -3.05 ALOGPS logp 1.66 ChemAxon pka_strongest_acidic 3.71 ChemAxon pka_strongest_basic -4.4 ChemAxon iupac (2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid ChemAxon average_mass 238.2366 ChemAxon mono_mass 238.084123558 ChemAxon smiles COC1=CC(\C=C\C(O)=O)=CC(OC)=C1OC ChemAxon formula C12H14O5 ChemAxon inchi InChI=1S/C12H14O5/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h4-7H,1-3H3,(H,13,14)/b5-4+ ChemAxon inchikey YTFVRYKNXDADBI-SNAWJCMRSA-N ChemAxon polar_surface_area 64.99 ChemAxon refractivity 62.45 ChemAxon polarizability 24.17 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 5 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon number_of_rings 1 ChemAxon bioavailability 1 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon Specdb::NmrOneD 1894 Specdb::NmrOneD 166623 Specdb::NmrTwoD 1830 Specdb::CMs 1529 Specdb::CMs 23887 Specdb::CMs 29827 Specdb::CMs 31420 Specdb::CMs 38434 Specdb::CMs 164916 Specdb::MsMs 2113 Specdb::MsMs 2114 Specdb::MsMs 2115 Specdb::MsMs 318928 Specdb::MsMs 318929 Specdb::MsMs 318930 Specdb::MsMs 365872 Specdb::MsMs 365873 Specdb::MsMs 365874 Specdb::MsMs 374866 Specdb::MsMs 439792 Specdb::MsMs 439793 Specdb::MsMs 445423 Specdb::MsMs 445424 Specdb::MsMs 445425 Specdb::MsMs 447427 Specdb::MsMs 447428 Specdb::MsMs 447429 Specdb::MsMs 447430 Specdb::MsMs 449966 Specdb::MsMs 449967 Specdb::MsMs 449968 Specdb::MsMs 449969 Specdb::MsMs 451591 Specdb::MsMs 452053 Milk Melzer N, Wittenburg D, Hartwig S, Jakubowski S, Kesting U, Willmitzer L, Lisec J, Reinsch N, Repsilber D: Investigating associations between milk metabolite profiles and milk traits of Holstein cows. J Dairy Sci. 2013 Mar;96(3):1521-34. doi: 10.3168/jds.2012-5743. 23438684 642910 FDB023019 735755 6705 Melzer N, Wittenburg D, Hartwig S, Jakubowski S, Kesting U, Willmitzer L, Lisec J, Reinsch N, Repsilber D: Investigating associations between milk metabolite profiles and milk traits of Holstein cows. J Dairy Sci. 2013 Mar;96(3):1521-34. doi: 10.3168/jds.2012-5743. 23438684