1.0 2016-09-30 23:05:18 UTC 2020-05-21 16:28:28 UTC BMDB0003556 BMDB03556 Chitobiose Chitobiose, also known as CBS or chitobiose, belongs to the class of organic compounds known as acylaminosugars. These are organic compounds containing a sugar linked to a chain through N-acyl group. Chitobiose is possibly soluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Chitobiose can be converted into N-acetyl-D-glucosamine; which is mediated by the enzyme Beta-hexosaminidase subunit alpha. In cattle, chitobiose is involved in the metabolic pathway called the amino sugar metabolism pathway. Chitobiose is a potentially toxic compound. CBS Chitodextrin Diacetylchitobiose C15H26N2O12 426.3731 426.148574306 [(2S,3R,4R,5S,6R)-2-{[(2R,3S,4R,5R,6R)-5-acetamido-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamic acid (2S,3R,4R,5S,6R)-2-{[(2R,3S,4R,5R,6R)-5-acetamido-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-ylcarbamic acid 577-76-4 CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(O)=O)[C@@H]1O InChI=1S/C15H26N2O12/c1-4(20)16-7-11(23)12(6(3-19)27-13(7)24)29-14-8(17-15(25)26)10(22)9(21)5(2-18)28-14/h5-14,17-19,21-24H,2-3H2,1H3,(H,16,20)(H,25,26)/t5-,6-,7-,8-,9-,10-,11-,12-,13-,14+/m1/s1 HSRZMOSQMYFZBL-CGKOVJDHSA-N belongs to the class of organic compounds known as acylaminosugars. These are organic compounds containing a sugar linked to a chain through N-acyl group. Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Acylaminosugars Acetals Acetamides Carbamic acids Carbonyl compounds Disaccharides Hemiacetals Hydrocarbon derivatives N-acyl-alpha-hexosamines O-glycosyl compounds Organic carbonic acids and derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Oxanes Primary alcohols Secondary alcohols Secondary carboxylic acid amides Acetal Acetamide Acylaminosugar Alcohol Aliphatic heteromonocyclic compound Carbamic acid Carbamic acid derivative Carbonic acid derivative Carbonyl group Carboxamide group Carboxylic acid derivative Disaccharide Glycosyl compound Hemiacetal Hydrocarbon derivative N-acyl-alpha-hexosamine O-glycosyl compound Organic nitrogen compound Organic oxide Organoheterocyclic compound Organonitrogen compound Organopnictogen compound Oxacycle Oxane Primary alcohol Secondary alcohol Secondary carboxylic acid amide Aliphatic heteromonocyclic compounds Solid logp -2.91 ALOGPS logs -0.62 ALOGPS logp -4.8 ChemAxon pka_strongest_acidic 3.51 ChemAxon pka_strongest_basic -3 ChemAxon iupac [(2S,3R,4R,5S,6R)-2-{[(2R,3S,4R,5R,6R)-5-acetamido-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamic acid ChemAxon average_mass 426.3731 ChemAxon mono_mass 426.148574306 ChemAxon smiles CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(O)=O)[C@@H]1O ChemAxon formula C15H26N2O12 ChemAxon inchi InChI=1S/C15H26N2O12/c1-4(20)16-7-11(23)12(6(3-19)27-13(7)24)29-14-8(17-15(25)26)10(22)9(21)5(2-18)28-14/h5-14,17-19,21-24H,2-3H2,1H3,(H,16,20)(H,25,26)/t5-,6-,7-,8-,9-,10-,11-,12-,13-,14+/m1/s1 ChemAxon inchikey HSRZMOSQMYFZBL-CGKOVJDHSA-N ChemAxon polar_surface_area 227.5 ChemAxon refractivity 87.39 ChemAxon polarizability 39.64 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 12 ChemAxon donor_count 9 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon number_of_rings 2 ChemAxon bioavailability 0 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon Amino Sugar Metabolism SMP0087175 Specdb::CMs 21920 Specdb::CMs 38629 Specdb::CMs 147973 Specdb::NmrOneD 28262 Specdb::NmrOneD 28263 Specdb::NmrOneD 28264 Specdb::NmrOneD 28265 Specdb::NmrOneD 28266 Specdb::NmrOneD 28267 Specdb::NmrOneD 28268 Specdb::NmrOneD 28269 Specdb::NmrOneD 28270 Specdb::NmrOneD 28271 Specdb::NmrOneD 28272 Specdb::NmrOneD 28273 Specdb::NmrOneD 28274 Specdb::NmrOneD 28275 Specdb::NmrOneD 28276 Specdb::NmrOneD 28277 Specdb::NmrOneD 28278 Specdb::NmrOneD 28279 Specdb::NmrOneD 28280 Specdb::NmrOneD 28281 Specdb::MsMs 23366 Specdb::MsMs 23367 Specdb::MsMs 23368 Specdb::MsMs 30164 Specdb::MsMs 30165 Specdb::MsMs 30166 Specdb::MsMs 3055685 Specdb::MsMs 3055686 Specdb::MsMs 3055687 Specdb::MsMs 3112130 Specdb::MsMs 3112131 Specdb::MsMs 3112132 Testis Wishart DS, Feunang YD, Marcu A, Guo AC, Liang K, Vazquez-Fresno R, Sajed T, Johnson D, Li C, Karu N, Sayeeda Z, Lo E, Assempour N, Berjanskii M, Singhal S, Arndt D, Liang Y, Badran H, Grant J, Serra-Cayuela A, Liu Y, Mandal R, Neveu V, Pon A, Knox C, Wilson M, Manach C, Scalbert A: HMDB 4.0: the human metabolome database for 2018. Nucleic Acids Res. 2018 Jan 4;46(D1):D608-D617. doi: 10.1093/nar/gkx1089. 29140435 FDB023196 17216232 C01674 22833609 CHITOBIOSE Chitobiose 6953 Cottaz, Sylvain; Samain, Eric. Genetic engineering of Escherichia coli for the production of NI,NII-diacetylchitobiose (chitinbiose) and its utilization as a primer for the synthesis of complex carbohydrates. Metabolic Engineering (2005), 7(4), 311-317. BMDBP00702 Acidic mammalian chitinase Q95M17 CHIA Enzyme