1.0 2016-09-30 23:22:04 UTC 2020-04-22 15:17:27 UTC BMDB0006456 BMDB06456 N-Acetyl-L-glutamyl 5-phosphate N-Acetyl-5-glutamyl phosphate N-Acetyl-5-oxo-5-(phosphonooxy)-L-norvaline N-Acetyl-L-glutamate 5-phosphate N-Acetyl-5-glutamyl phosphoric acid N-Acetyl-L-glutamic acid 5-phosphoric acid N-Acetyl-L-glutamyl 5-phosphoric acid (2S)-2-acetamido-5-oxo-5-(Phosphonooxy)pentanoate (2S)-2-acetamido-5-oxo-5-(Phosphonooxy)pentanoic acid N-Acetyl-gamma-L-glutamyl phosphate N-Acetyl-gamma-glutamyl phosphate N-Acetyl-γ-glutamyl phosphate C7H12NO8P 269.1458 269.030052877 (2S)-2-acetamido-5-oxo-5-(phosphonooxy)pentanoic acid (2S)-2-acetamido-5-oxo-5-(phosphonooxy)pentanoic acid 15383-57-0 CC(=O)N[C@@H](CCC(=O)OP(O)(O)=O)C(O)=O InChI=1S/C7H12NO8P/c1-4(9)8-5(7(11)12)2-3-6(10)16-17(13,14)15/h5H,2-3H2,1H3,(H,8,9)(H,11,12)(H2,13,14,15)/t5-/m0/s1 FCVIHFVSXHOPSW-YFKPBYRVSA-N belongs to the class of organic compounds known as glutamic acid and derivatives. Glutamic acid and derivatives are compounds containing glutamic acid or a derivative thereof resulting from reaction of glutamic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Glutamic acid and derivatives Acetamides Acyl monophosphates Carbonyl compounds Carboxylic acid salts Carboxylic acids Dicarboxylic acids and derivatives Fatty acids and conjugates Hydrocarbon derivatives N-acyl-L-alpha-amino acids Organic oxides Organic salts Organonitrogen compounds Organopnictogen compounds Secondary carboxylic acid amides Acetamide Acyl monophosphate Acyl phosphate Aliphatic acyclic compound Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid salt Dicarboxylic acid or derivatives Fatty acid Glutamic acid or derivatives Hydrocarbon derivative N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-l-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organic phosphoric acid derivative Organic salt Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary carboxylic acid amide Aliphatic acyclic compounds L-glutamic acid derivative Solid logp -1.92 ALOGPS logs -1.87 ALOGPS logp -1.8 ChemAxon pka_strongest_acidic 1.23 ChemAxon pka_strongest_basic -1.8 ChemAxon iupac (2S)-2-acetamido-5-oxo-5-(phosphonooxy)pentanoic acid ChemAxon average_mass 269.1458 ChemAxon mono_mass 269.030052877 ChemAxon smiles CC(=O)N[C@@H](CCC(=O)OP(O)(O)=O)C(O)=O ChemAxon formula C7H12NO8P ChemAxon inchi InChI=1S/C7H12NO8P/c1-4(9)8-5(7(11)12)2-3-6(10)16-17(13,14)15/h5H,2-3H2,1H3,(H,8,9)(H,11,12)(H2,13,14,15)/t5-/m0/s1 ChemAxon inchikey FCVIHFVSXHOPSW-YFKPBYRVSA-N ChemAxon polar_surface_area 150.23 ChemAxon refractivity 51.89 ChemAxon polarizability 21.95 ChemAxon rotatable_bond_count 7 ChemAxon acceptor_count 7 ChemAxon donor_count 4 ChemAxon physiological_charge -3 ChemAxon formal_charge 0 ChemAxon number_of_rings 0 ChemAxon bioavailability 1 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon Specdb::CMs 2853 Specdb::CMs 39016 Specdb::CMs 162302 Specdb::MsMs 25139 Specdb::MsMs 25140 Specdb::MsMs 25141 Specdb::MsMs 31697 Specdb::MsMs 31698 Specdb::MsMs 31699 Specdb::MsMs 2422548 Specdb::MsMs 2422549 Specdb::MsMs 2422550 Specdb::MsMs 2512614 Specdb::MsMs 2512615 Specdb::MsMs 2512616 Specdb::NmrOneD 150180 Specdb::NmrOneD 150181 Specdb::NmrOneD 150182 Specdb::NmrOneD 150183 Specdb::NmrOneD 150184 Specdb::NmrOneD 150185 Specdb::NmrOneD 150186 Specdb::NmrOneD 150187 Specdb::NmrOneD 150188 Specdb::NmrOneD 150189 Specdb::NmrOneD 150190 Specdb::NmrOneD 150191 Specdb::NmrOneD 150192 Specdb::NmrOneD 150193 Specdb::NmrOneD 150194 Specdb::NmrOneD 150195 Specdb::NmrOneD 150196 Specdb::NmrOneD 150197 Specdb::NmrOneD 150198 Specdb::NmrOneD 150199 FDB023917 389220 440236 16878 X2W C04133 N-ACETYL-GLUTAMYL-P 43209 3396 Kuramitsu, Shigenori; Masui, Ryoji. Cloning of thermostable acetylglutamate kinase gene from Sulfolobus tokodaii and use for N-acetyl-L-glutamate-5-phosphate biosynthesis. Jpn. Kokai Tokkyo Koho (2004), 12 pp. CODEN: JKXXAF JP 2004298187 A 20041028 CAN 141:362386 AN 2004:900796