1.0 2016-10-03 18:12:30 UTC 2020-05-21 16:27:14 UTC BMDB0010720 BMDB10720 But-2-enoic acid But-2-enoic acid, also known as but-2-enoic acid or (2E)-But-2-enoic acid, belongs to the class of organic compounds known as straight chain fatty acids. These are fatty acids with a straight aliphatic chain. But-2-enoic acid exists as a solid, very hydrophobic, practically insoluble (in water), and relatively neutral molecule. But-2-enoic acid exists in all living species, ranging from bacteria to humans. But-2-enoic acid participates in a number of enzymatic reactions, within cattle. In particular, But-2-enoic acid can be biosynthesized from 3-hydroxybutyric acid; which is catalyzed by the enzyme fatty acid synthase. dyhydrase domain. In addition, But-2-enoic acid can be converted into butyric acid through its interaction with the enzyme fatty acid synthase. enoyl reductase domain. In cattle, but-2-enoic acid is involved in the metabolic pathway called fatty acid biosynthesis pathway. (2E)-2-Butenoic acid (e)-2-Butenoic acid (e)-But-2-enoic acid (e)-Crotonic acid 2-Butenoic acid 3-Methylacrylic acid alpha-Butenoic acid alpha-Crotonic acid BEO beta-Methacrylic acid beta-Methylacrylic acid trans-2-Butenoic acid trans-Crotonic acid Crotonic acid (2E)-2-Butenoate (e)-2-Butenoate (e)-But-2-enoate (e)-Crotonate 2-Butenoate 3-Methylacrylate a-Butenoate a-Butenoic acid alpha-Butenoate Α-butenoate Α-butenoic acid a-Crotonate a-Crotonic acid alpha-Crotonate Α-crotonate Α-crotonic acid b-Methacrylate b-Methacrylic acid beta-Methacrylate Β-methacrylate Β-methacrylic acid b-Methylacrylate b-Methylacrylic acid beta-Methylacrylate Β-methylacrylate Β-methylacrylic acid trans-2-Butenoate trans-Crotonate Crotonate But-2-enoate (2E)-But-2-enoate (2E)-But-2-enoic acid 3-Methyl-acrylic acid Butenoate Butenoic acid Kyselina krotonova Solid crotonic acid C4H6O2 86.0892 86.036779436 (2E)-but-2-enoic acid butenoic acid 3724-65-0 C\C=C\C(O)=O InChI=1S/C4H6O2/c1-2-3-4(5)6/h2-3H,1H3,(H,5,6)/b3-2+ LDHQCZJRKDOVOX-NSCUHMNNSA-N belongs to the class of organic compounds known as straight chain fatty acids. These are fatty acids with a straight aliphatic chain. Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Straight chain fatty acids Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid Aliphatic acyclic compounds 2-butenoic acid Unsaturated fatty acids Solid melting_point 72 °C logp 0.72 HANSCH,C ET AL. (1995) logp 0.94 ALOGPS logs 0.07 ALOGPS logp 0.92 ChemAxon pka_strongest_acidic 4.9 ChemAxon iupac (2E)-but-2-enoic acid ChemAxon average_mass 86.0892 ChemAxon mono_mass 86.036779436 ChemAxon smiles C\C=C\C(O)=O ChemAxon formula C4H6O2 ChemAxon inchi InChI=1S/C4H6O2/c1-2-3-4(5)6/h2-3H,1H3,(H,5,6)/b3-2+ ChemAxon inchikey LDHQCZJRKDOVOX-NSCUHMNNSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 22.96 ChemAxon polarizability 8.44 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon number_of_rings 0 ChemAxon bioavailability 1 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon Fatty Acid Biosynthesis SMP0087257 Specdb::CMs 2879 Specdb::CMs 29452 Specdb::CMs 39528 Specdb::CMs 99950 Specdb::CMs 158315 Specdb::MsIr 2474 Specdb::MsIr 2475 Specdb::MsIr 2476 Specdb::MsMs 88608 Specdb::MsMs 88609 Specdb::MsMs 88610 Specdb::MsMs 151368 Specdb::MsMs 151369 Specdb::MsMs 151370 Specdb::MsMs 437461 Specdb::MsMs 437462 Specdb::MsMs 437463 Specdb::MsMs 437464 Specdb::MsMs 2252371 Specdb::MsMs 2254446 Specdb::MsMs 2256110 Specdb::MsMs 2453008 Specdb::MsMs 2453009 Specdb::MsMs 2453010 Specdb::MsMs 2482714 Specdb::MsMs 2482715 Specdb::MsMs 2482716 Specdb::NmrOneD 4601 Specdb::NmrOneD 266168 Specdb::NmrOneD 266169 Specdb::NmrOneD 266170 Specdb::NmrOneD 266171 Specdb::NmrOneD 266172 Specdb::NmrOneD 266173 Specdb::NmrOneD 266174 Specdb::NmrOneD 266175 Specdb::NmrOneD 266176 Specdb::NmrOneD 266177 Specdb::NmrOneD 266178 Specdb::NmrOneD 266179 Specdb::NmrOneD 266180 Specdb::NmrOneD 266181 Specdb::NmrOneD 266182 Specdb::NmrOneD 266183 Specdb::NmrOneD 266184 Specdb::NmrOneD 266185 Specdb::NmrOneD 266186 Specdb::NmrOneD 266187 FDB003283 552744 DB02074 C01771 637090 41131 BEO CROTONATE Crotonic_acid BMDBP00368 Fatty acid synthase Q71SP7 FASN Enzyme